On Target NMDZ1_HUMAN 0.30769232/CHEMBL419399
For the given ligand Methadone, we have found in our database that, being scored 0.30769232, the most similar ligand is CHEMBL419399. Check out the elaboration below.
| Methadone (Given Ligand) | CHEMBL419399 (Similar Ligand) |
|---|---|
| CCC(=O)C(CC(C)N(C)C)(c1ccccc1)c2ccccc2 | Cc1ccc(CC2CCN(CC#Cc3ccc4[nH]c(O)nc4c3)CC2)cc1 |
|
|
|
|
|
|
| 00030000 01000200 00100102 00010600 00000000 00000000 00000000 01000000 00000800 000808c0 08300000 40019000 05008000 00200000 40000000 00040000 00000000 02000000 00002000 00000001 00000100 18000210 00000000 00500010 00000000 a0000000 00000000 50000000 00000080 0006000a 00022000 00800600 | 00000202 01020810 00120902 040d0600 00442040 00004000 00000000 20100020 00100900 000808c0 09308004 50018800 00000002 00600000 60100140 000c000c 00000000 02000024 00200000 00000201 40020100 18900020 21890001 02500010 00000084 80000000 00000240 10000000 03400000 00460002 40000020 040006a0 |