|
Name | Oxycodone |
2D and 3D depictions |
|
SMILES | COc2ccc1C[C@H]4N(C)CC[C@]35c1c2O[C@H]3C(=O)CC[C@@]45O |
Model downloads | |
Fingerprints |
Name | Morphine |
2D and 3D depictions |
|
SMILES | CN4CC[C@]23c1c5ccc(O)c1O[C@H]2C(O)/C=C\[C@H]3[C@H]4C5 |
Model downloads | |
Fingerprints |
Name | Methadone |
2D and 3D depictions |
|
SMILES | CCC(=O)C(CC(C)N(C)C)(c1ccccc1)c2ccccc2 |
Model downloads | |
Fingerprints |
Name | Pethidine |
2D and 3D depictions |
|
SMILES | CCOC(=O)C2(c1ccccc1)CCN(C)CC2 |
Model downloads | |
Fingerprints |
Name | Fentanyl |
2D and 3D depictions |
|
SMILES | CCC(=O)N(c1ccccc1)C3CCN(CCc2ccccc2)CC3 |
Model downloads | |
Fingerprints |