On Target TRPV1_RAT 0.43925235/CHEMBL1940379
For the given ligand Methadone, we have found in our database that, being scored 0.43925235, the most similar ligand is CHEMBL1940379. Check out the elaboration below.
| Methadone (Given Ligand) | CHEMBL1940379 (Similar Ligand) |
|---|---|
| CCC(=O)C(CC(C)N(C)C)(c1ccccc1)c2ccccc2 | CC(C(=O)NCC1CC1(c2ccccc2)c3ccccc3)c4ccc(NS(=O)(=O)C)c(F)c4 |
|
|
|
|
|
|
| 00030000 01000200 00100102 00010600 00000000 00000000 00000000 01000000 00000800 000808c0 08300000 40019000 05008000 00200000 40000000 00040000 00000000 02000000 00002000 00000001 00000100 18000210 00000000 00500010 00000000 a0000000 00000000 50000000 00000080 0006000a 00022000 00800600 | 00000002 01001a00 00100102 42310600 00000000 00400010 00000000 21000000 00100980 000828c0 08302004 50019000 01008402 01201001 c0080040 00060000 00000400 12000000 00000000 00004201 40000100 18240e00 20000000 81500018 00000084 a0000000 80000000 5000000d 04200080 0006800b 00002000 00012660 |