On Target TRPV1_RAT 0.5/CHEMBL1277028
For the given ligand Pethidine, we have found in our database that, being scored 0.5, the most similar ligand is CHEMBL1277028. Check out the elaboration below.
| Pethidine (Given Ligand) | CHEMBL1277028 (Similar Ligand) |
|---|---|
| CCOC(=O)C2(c1ccccc1)CCN(C)CC2 | CC(C)(C)C(=O)OCC(CNC(=O)Cc1cc(Br)cc(Br)c1)Cc2ccc(cc2)C(C)(C)C |
|
|
|
|
|
|
| 00020000 01000200 00100100 00010700 00100040 00000000 00000000 20000040 00000800 000808c0 08300000 50019000 05008002 00000000 40040000 000c1008 08020000 02000000 04400000 00000201 00010120 18000a00 01000000 00500010 00000400 80000000 00000200 10000000 00000200 0006000a 00002000 00800e00 | 00004040 10009208 00100100 00010700 00000000 00000000 00000000 28000000 40000980 000808c0 18300000 c0009800 01008012 00080000 40000000 000c1008 00220000 02000000 00c00000 00000201 00000120 18340e00 010000c0 81400018 00000421 80000000 00020000 10000000 05000200 0006000f 00002008 08002600 |