On Target PAR1_HUMAN 0.5176471/CHEMBL3658406
For the given ligand Methadone, we have found in our database that, being scored 0.5176471, the most similar ligand is CHEMBL3658406. Check out the elaboration below.
| Methadone (Given Ligand) | CHEMBL3658406 (Similar Ligand) |
|---|---|
| CCC(=O)C(CC(C)N(C)C)(c1ccccc1)c2ccccc2 | CCc1ccc(cc1)C2CC(CN(C2)C(=O)C3CCCC3)NC(=O)C(C)(C)C |
|
|
|
|
|
|
| 00030000 01000200 00100102 00010600 00000000 00000000 00000000 01000000 00000800 000808c0 08300000 40019000 05008000 00200000 40000000 00040000 00000000 02000000 00002000 00000001 00000100 18000210 00000000 00500010 00000000 a0000000 00000000 50000000 00000080 0006000a 00022000 00800600 | 00010000 01003200 00100102 04010600 00000000 00000000 00000000 2000000c 00300980 000808c0 08300000 50039800 0400800a 00202000 00000000 00040000 00000000 02000000 00002000 00000201 00000100 38240610 00000001 83500018 00000000 80000000 00000000 10000000 0c000000 0106000b 00000000 00002600 |