On Target MK01_HUMAN 0.40869564/CHEMBL3752989
For the given ligand Pethidine, we have found in our database that, being scored 0.40869564, the most similar ligand is CHEMBL3752989. Check out the elaboration below.
| Pethidine (Given Ligand) | CHEMBL3752989 (Similar Ligand) |
|---|---|
| CCOC(=O)C2(c1ccccc1)CCN(C)CC2 | CC[C@H](C)[C@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](N)CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C)C(=O)N[C@@H](CC(C)C)C(=O)O |
|
|
|
|
|
|
| 00020000 01000200 00100100 00010700 00100040 00000000 00000000 20000040 00000800 000808c0 08300000 50019000 05008002 00000000 40040000 000c1008 08020000 02000000 04400000 00000201 00010120 18000a00 01000000 00500010 00000400 80000000 00000200 10000000 00000200 0006000a 00002000 00800e00 | 00010000 01007208 20100100 04010600 00080080 00000000 02000000 2000000c 00000880 000808c0 08300000 4001b000 0600800a 00002001 80180000 000c0008 10000000 02000000 00402008 00020201 00000100 38240e30 03000003 83500018 00000800 80000000 00120000 10000000 0c000000 0006000b 20004000 00002600 |