On Target HYES_HUMAN 0.5735294/CHEMBL2031923
For the given ligand Methadone, we have found in our database that, being scored 0.5735294, the most similar ligand is CHEMBL2031923. Check out the elaboration below.
| Methadone (Given Ligand) | CHEMBL2031923 (Similar Ligand) |
|---|---|
| CCC(=O)C(CC(C)N(C)C)(c1ccccc1)c2ccccc2 | O=C(NCCCc1ccccc1)NC23CC4CC(CC(C4)C2)C3 |
|
|
|
|
|
|
| 00030000 01000200 00100102 00010600 00000000 00000000 00000000 01000000 00000800 000808c0 08300000 40019000 05008000 00200000 40000000 00040000 00000000 02000000 00002000 00000001 00000100 18000210 00000000 00500010 00000000 a0000000 00000000 50000000 00000080 0006000a 00022000 00800600 | 00000000 01001200 00100100 00010e00 00000000 00000000 00000004 00002000 00000800 000808c0 08300000 40018000 00009000 00000000 00000000 00040000 00000000 02000000 02002040 00000001 00000100 18050410 00000000 00500018 00010000 80000000 00000000 10000000 00000000 0006000b 000a0000 00000600 |