On Target CHLE_HUMAN 0.40625/CHEMBL3818250
For the given ligand Methadone, we have found in our database that, being scored 0.40625, the most similar ligand is CHEMBL3818250. Check out the elaboration below.
| Methadone (Given Ligand) | CHEMBL3818250 (Similar Ligand) |
|---|---|
| CCC(=O)C(CC(C)N(C)C)(c1ccccc1)c2ccccc2 | COc1cc(CCC(=O)NCCC2CCN(Cc3ccccc3)CC2)ccc1O |
|
|
|
|
|
|
| 00030000 01000200 00100102 00010600 00000000 00000000 00000000 01000000 00000800 000808c0 08300000 40019000 05008000 00200000 40000000 00040000 00000000 02000000 00002000 00000001 00000100 18000210 00000000 00500010 00000000 a0000000 00000000 50000000 00000080 0006000a 00022000 00800600 | 00000000 43001208 20100108 00010600 00001000 40000000 02000000 22001000 00000800 000808c0 08300000 50019000 0400c802 20000000 01000401 00048008 00000000 02000000 00080008 00020201 00000100 18048620 00000000 00500018 00000800 c0000000 00120000 90000000 00000300 0006000b 20040000 00002600 |