On Target CHLE_HUMAN 0.47916666/CHEMBL229105
For the given ligand Pethidine, we have found in our database that, being scored 0.47916666, the most similar ligand is CHEMBL229105. Check out the elaboration below.
| Pethidine (Given Ligand) | CHEMBL229105 (Similar Ligand) |
|---|---|
| CCOC(=O)C2(c1ccccc1)CCN(C)CC2 | Fc1ccc(cc1)C(=O)OCCCCN2CCC(CC2)OCc3ccccc3 |
|
|
|
|
|
|
| 00020000 01000200 00100100 00010700 00100040 00000000 00000000 20000040 00000800 000808c0 08300000 50019000 05008002 00000000 40040000 000c1008 08020000 02000000 04400000 00000201 00010120 18000a00 01000000 00500010 00000400 80000000 00000200 10000000 00000200 0006000a 00002000 00800e00 | 00000000 01000800 00100100 02010700 00100010 00004010 00000000 20000000 00000100 000008c0 00200000 50018000 00008002 00091000 00200000 02081008 00220000 02000200 00c00000 00100201 00000020 18020a20 01000080 00500014 00000401 80002000 00080200 10000001 00000200 00068002 c0000000 02002a00 |