On Target PDE4B_HUMAN 0.43119267/CHEMBL144499
For the given ligand Methadone, we have found in our database that, being scored 0.43119267, the most similar ligand is CHEMBL144499. Check out the elaboration below.
| Methadone (Given Ligand) | CHEMBL144499 (Similar Ligand) |
|---|---|
| CCC(=O)C(CC(C)N(C)C)(c1ccccc1)c2ccccc2 | COc1ccc(cc1OC2CCCC2)[C@H]3CCN4[C@@H]3CCC4=O |
|
|
|
|
|
|
| 00030000 01000200 00100102 00010600 00000000 00000000 00000000 01000000 00000800 000808c0 08300000 40019000 05008000 00200000 40000000 00040000 00000000 02000000 00002000 00000001 00000100 18000210 00000000 00500010 00000000 a0000000 00000000 50000000 00000080 0006000a 00022000 00800600 | 04030000 43001208 2010010a 00210700 00081000 c2000010 02040000 20000004 00000880 000808c0 08300000 40019000 0480c00a 20200080 11000001 020ca008 00800000 02000000 00482000 00020201 00000100 18240610 01000000 81500018 00000000 80000000 00120000 10000000 04000202 0106000b 00020000 00802640 |