On Target PDE4B_HUMAN 0.41935483/CHEMBL61727
For the given ligand Pethidine, we have found in our database that, being scored 0.41935483, the most similar ligand is CHEMBL61727. Check out the elaboration below.
| Pethidine (Given Ligand) | CHEMBL61727 (Similar Ligand) |
|---|---|
| CCOC(=O)C2(c1ccccc1)CCN(C)CC2 | COC(=O)[C@@H]1CN(C[C@H]1c2ccc(OC)c(OC3CCCC3)c2)C=O |
|
|
|
|
|
|
| 00020000 01000200 00100100 00010700 00100040 00000000 00000000 20000040 00000800 000808c0 08300000 50019000 05008002 00000000 40040000 000c1008 08020000 02000000 04400000 00000201 00010120 18000a00 01000000 00500010 00000400 80000000 00000200 10000000 00000200 0006000a 00002000 00800e00 | 04020000 43001208 20100108 00210700 00181000 c2000010 02040000 00000004 00000880 000808c0 08300000 40009000 0c80c002 20000080 11000001 020ca008 00a20000 02000001 00c80018 00020201 00000100 18340e00 010000c0 81400018 00001801 80000000 00120200 10000000 04000200 0106000b 00000000 00802e40 |