On Target ACM4_HUMAN 0.6351351/CHEMBL2112956
For the given ligand Methadone, we have found in our database that, being scored 0.6351351, the most similar ligand is CHEMBL2112956. Check out the elaboration below.
| Methadone (Given Ligand) | CHEMBL2112956 (Similar Ligand) |
|---|---|
| CCC(=O)C(CC(C)N(C)C)(c1ccccc1)c2ccccc2 | O=C(CCCCCNC(=O)CC(c1ccccc1)(c2ccccc2)c3ccccc3)NC[C@H]4CCCN(CC5CCCCC5)C4 |
|
|
|
|
|
|
| 00030000 01000200 00100102 00010600 00000000 00000000 00000000 01000000 00000800 000808c0 08300000 40019000 05008000 00200000 40000000 00040000 00000000 02000000 00002000 00000001 00000100 18000210 00000000 00500010 00000000 a0000000 00000000 50000000 00000080 0006000a 00022000 00800600 | 00010000 01001600 00100100 00010600 00000000 00000000 00000000 21000000 00000800 000809e0 08300000 50019000 0400800a 00000000 00000000 00040000 00000000 02000000 02002008 00000201 00000100 180c0630 00000000 00500018 00000800 a0000000 00000000 50000000 00000080 0006001b 00020000 00002600 |