On Target ACM4_HUMAN 0.75/CHEMBL285898
For the given ligand Pethidine, we have found in our database that, being scored 0.75, the most similar ligand is CHEMBL285898. Check out the elaboration below.
| Pethidine (Given Ligand) | CHEMBL285898 (Similar Ligand) |
|---|---|
| CCOC(=O)C2(c1ccccc1)CCN(C)CC2 | CCN(CC)CCCCOC(=O)C(C)(C1CCCCC1)c2ccccc2 |
|
|
|
|
|
|
| 00020000 01000200 00100100 00010700 00100040 00000000 00000000 20000040 00000800 000808c0 08300000 50019000 05008002 00000000 40040000 000c1008 08020000 02000000 04400000 00000201 00010120 18000a00 01000000 00500010 00000400 80000000 00000200 10000000 00000200 0006000a 00002000 00800e00 | 00010040 01000000 00100102 00010700 00180040 00000000 00000000 20000040 00000800 000808c0 08300000 40009000 0500800a 00a00000 40040000 00081008 08820000 02000000 06402000 00000201 00010120 18000a00 01000000 00400010 00000400 80000000 00000200 10000000 00000202 00060002 00022000 00000e00 |