On Target TNFA_HUMAN 0.44545454/CHEMBL76297
For the given ligand Pethidine, we have found in our database that, being scored 0.44545454, the most similar ligand is CHEMBL76297. Check out the elaboration below.
| Pethidine (Given Ligand) | CHEMBL76297 (Similar Ligand) |
|---|---|
| CCOC(=O)C2(c1ccccc1)CCN(C)CC2 | CNC(=O)[C@@H](NC(=O)[C@@H]([C@H](CO)C(=O)NO)c1ccccc1)C(C)(C)C |
|
|
|
|
|
|
| 00020000 01000200 00100100 00010700 00100040 00000000 00000000 20000040 00000800 000808c0 08300000 50019000 05008002 00000000 40040000 000c1008 08020000 02000000 04400000 00000201 00010120 18000a00 01000000 00500010 00000400 80000000 00000200 10000000 00000200 0006000a 00002000 00800e00 | 00060000 00003210 40100100 04010600 00100000 00000000 08000000 20000008 00200880 000808c0 08300000 4002b000 17008016 00002000 c0000000 00080018 00000000 02000000 00c00008 00040201 00000100 38200600 01000041 83400018 00002800 80000000 00000000 10000000 0c000002 0006000f 20006000 02802e00 |