On Target BACE1_HUMAN 0.4827586/CHEMBL1092504
For the given ligand Methadone, we have found in our database that, being scored 0.4827586, the most similar ligand is CHEMBL1092504. Check out the elaboration below.
| Methadone (Given Ligand) | CHEMBL1092504 (Similar Ligand) |
|---|---|
| CCC(=O)C(CC(C)N(C)C)(c1ccccc1)c2ccccc2 | CCCCNC(=O)[C@H](C)C[C@H](O)[C@H](Cc1ccccc1)NC(=O)[C@@H]2CCC[C@@H](C2)[C@@H](NC(=O)C)C(C)C |
|
|
|
|
|
|
| 00030000 01000200 00100102 00010600 00000000 00000000 00000000 01000000 00000800 000808c0 08300000 40019000 05008000 00200000 40000000 00040000 00000000 02000000 00002000 00000001 00000100 18000210 00000000 00500010 00000000 a0000000 00000000 50000000 00000080 0006000a 00022000 00800600 | 00050000 01005000 00100102 00010600 00100080 00000000 00000000 20000004 00000880 000808c0 08300000 40019000 0400801a 00200000 00080000 00080008 10000000 02000000 02402000 00000201 00000100 18240630 03000040 81500018 00000000 80000000 00000000 10000000 04000002 00060003 00020000 00002e00 |