On Target BACE1_HUMAN 0.45918366/CHEMBL1092504
For the given ligand Pethidine, we have found in our database that, being scored 0.45918366, the most similar ligand is CHEMBL1092504. Check out the elaboration below.
| Pethidine (Given Ligand) | CHEMBL1092504 (Similar Ligand) |
|---|---|
| CCOC(=O)C2(c1ccccc1)CCN(C)CC2 | CCCCNC(=O)[C@H](C)C[C@H](O)[C@H](Cc1ccccc1)NC(=O)[C@@H]2CCC[C@@H](C2)[C@@H](NC(=O)C)C(C)C |
|
|
|
|
|
|
| 00020000 01000200 00100100 00010700 00100040 00000000 00000000 20000040 00000800 000808c0 08300000 50019000 05008002 00000000 40040000 000c1008 08020000 02000000 04400000 00000201 00010120 18000a00 01000000 00500010 00000400 80000000 00000200 10000000 00000200 0006000a 00002000 00800e00 | 00050000 01005000 00100102 00010600 00100080 00000000 00000000 20000004 00000880 000808c0 08300000 40019000 0400801a 00200000 00080000 00080008 10000000 02000000 02402000 00000201 00000100 18240630 03000040 81500018 00000000 80000000 00000000 10000000 04000002 00060003 00020000 00002e00 |