On Target NEP_HUMAN 0.5769231/CHEMBL213404
For the given ligand Methadone, we have found in our database that, being scored 0.5769231, the most similar ligand is CHEMBL213404. Check out the elaboration below.
| Methadone (Given Ligand) | CHEMBL213404 (Similar Ligand) |
|---|---|
| CCC(=O)C(CC(C)N(C)C)(c1ccccc1)c2ccccc2 | CCCC(CC1(CCCC1)C(=O)N[C@@H]2CCCC[C@@H]2Cc3ccccc3)C(=O)O |
|
|
|
|
|
|
| 00030000 01000200 00100102 00010600 00000000 00000000 00000000 01000000 00000800 000808c0 08300000 40019000 05008000 00200000 40000000 00040000 00000000 02000000 00002000 00000001 00000100 18000210 00000000 00500010 00000000 a0000000 00000000 50000000 00000080 0006000a 00022000 00800600 | 00010000 01001200 00100102 00010600 00080000 00000000 00000000 20000000 00000800 000a08c0 08300000 40019000 0400803a 01a00000 00000000 000c0008 00000000 02000000 02402000 00000201 00000100 18040e10 01000000 00500018 00000000 80000000 00000000 10000000 00000002 0106000b 00020000 00002600 |