On Target HPGDS_HUMAN 0.3/CHEMBL3650199
For the given ligand Pethidine, we have found in our database that, being scored 0.3, the most similar ligand is CHEMBL3650199. Check out the elaboration below.
| Pethidine (Given Ligand) | CHEMBL3650199 (Similar Ligand) |
|---|---|
| CCOC(=O)C2(c1ccccc1)CCN(C)CC2 | Cn1cccc1C(=O)N2CCN(CC2)C(=O)Nc3ccc(cc3)N4CCC(CC4)C(=O)O |
|
|
|
|
|
|
| 00020000 01000200 00100100 00010700 00100040 00000000 00000000 20000040 00000800 000808c0 08300000 50019000 05008002 00000000 40040000 000c1008 08020000 02000000 04400000 00000201 00010120 18000a00 01000000 00500010 00000400 80000000 00000200 10000000 00000200 0006000a 00002000 00800e00 | 00024006 0100b800 00100100 14000e00 20100020 00102000 00000004 22003009 00000000 000308c0 00290004 50019000 0400a802 00102000 00020440 000c010c 00040010 02400006 08600000 00020201 40100101 38078e00 21822020 0250001c 00100000 40000000 00000000 90000080 08008104 00060041 80000200 00804a00 |