On Target NOS1_HUMAN 0.3678161/CHEMBL6875
For the given ligand Methadone, we have found in our database that, being scored 0.3678161, the most similar ligand is CHEMBL6875. Check out the elaboration below.
| Methadone (Given Ligand) | CHEMBL6875 (Similar Ligand) |
|---|---|
| CCC(=O)C(CC(C)N(C)C)(c1ccccc1)c2ccccc2 | NC1=NC(Cc2ccccc2)CCC1 |
|
|
|
|
|
|
| 00030000 01000200 00100102 00010600 00000000 00000000 00000000 01000000 00000800 000808c0 08300000 40019000 05008000 00200000 40000000 00040000 00000000 02000000 00002000 00000001 00000100 18000210 00000000 00500010 00000000 a0000000 00000000 50000000 00000080 0006000a 00022000 00800600 | 00000002 01000000 00200102 00010e00 00000000 00000000 10010000 00002000 00000800 200808c3 08110110 40018000 00000001 00202008 00000000 20000000 00000800 02000002 00002000 00000001 00000101 38010030 00000000 83400810 00000000 80020000 40010000 00000000 0c200002 00060002 00020000 00000400 |