On Target NOS1_HUMAN 0.3846154/CHEMBL1270460
For the given ligand Pethidine, we have found in our database that, being scored 0.3846154, the most similar ligand is CHEMBL1270460. Check out the elaboration below.
| Pethidine (Given Ligand) | CHEMBL1270460 (Similar Ligand) |
|---|---|
| CCOC(=O)C2(c1ccccc1)CCN(C)CC2 | Fc1cccc(CCNCCO[C@H]2CNC[C@H]2CC3CCCC(=N)N3)c1 |
|
|
|
|
|
|
| 00020000 01000200 00100100 00010700 00100040 00000000 00000000 20000040 00000800 000808c0 08300000 50019000 05008002 00000000 40040000 000c1008 08020000 02000000 04400000 00000201 00010120 18000a00 01000000 00500010 00000400 80000000 00000200 10000000 00000200 0006000a 00002000 00800e00 | 00000000 01000000 00100100 82010f00 00180080 00000010 00000000 20002000 00200280 000828c3 08210000 50038000 00000002 00881000 00081008 00181008 10a00000 02000000 00c02000 00000201 00000020 18230030 13000080 81500010 30000400 80000000 c0000200 10000001 04200210 00068002 80020000 00002e00 |