On Target NK1R_HUMAN 0.6184211/CHEMBL1817817
For the given ligand Methadone, we have found in our database that, being scored 0.6184211, the most similar ligand is CHEMBL1817817. Check out the elaboration below.
| Methadone (Given Ligand) | CHEMBL1817817 (Similar Ligand) |
|---|---|
| CCC(=O)C(CC(C)N(C)C)(c1ccccc1)c2ccccc2 | Cl.O=C1CCN(Cc2ccccc2)CC1C(c3ccccc3)c4ccccc4 |
|
|
|
|
|
|
| 00030000 01000200 00100102 00010600 00000000 00000000 00000000 01000000 00000800 000808c0 08300000 40019000 05008000 00200000 40000000 00040000 00000000 02000000 00002000 00000001 00000100 18000210 00000000 00500010 00000000 a0000000 00000000 50000000 00000080 0006000a 00022000 00800600 | 00000000 01000200 00100102 00010600 00000000 00000000 00000000 23001000 00000800 000808c0 08300000 50019000 0c008802 00200000 00000400 00040000 00000000 02000000 00002018 00000201 00000100 18008210 00000000 00500010 00001800 e0000000 00000000 d0000000 00000182 0006000a 20040000 00022600 |