On Target NK1R_HUMAN 0.69135803/CHEMBL277918
For the given ligand Pethidine, we have found in our database that, being scored 0.69135803, the most similar ligand is CHEMBL277918. Check out the elaboration below.
| Pethidine (Given Ligand) | CHEMBL277918 (Similar Ligand) |
|---|---|
| CCOC(=O)C2(c1ccccc1)CCN(C)CC2 | Cc1cc(C)cc(COCC2(CCNCC2)c3ccccc3)c1 |
|
|
|
|
|
|
| 00020000 01000200 00100100 00010700 00100040 00000000 00000000 20000040 00000800 000808c0 08300000 50019000 05008002 00000000 40040000 000c1008 08020000 02000000 04400000 00000201 00010120 18000a00 01000000 00500010 00000400 80000000 00000200 10000000 00000200 0006000a 00002000 00800e00 | 00000000 01000200 00100100 00010700 00100051 00004000 00000000 20000040 00000900 000808c0 08300000 50018000 00000002 00010000 00040000 020c1008 08000000 02000000 04400000 40000201 00010120 18000020 01000000 00400010 00000400 80002000 00080200 10000000 00000200 0006000a 40000004 02000e00 |