On Target ALDR_HUMAN 0.39285713/CHEMBL77283
For the given ligand Pethidine, we have found in our database that, being scored 0.39285713, the most similar ligand is CHEMBL77283. Check out the elaboration below.
| Pethidine (Given Ligand) | CHEMBL77283 (Similar Ligand) |
|---|---|
| CCOC(=O)C2(c1ccccc1)CCN(C)CC2 | OC(=O)Cc1cc(O)c2C(=O)c3ccccc3C=Cc2c1 |
|
|
|
|
|
|
| 00020000 01000200 00100100 00010700 00100040 00000000 00000000 20000040 00000800 000808c0 08300000 50019000 05008002 00000000 40040000 000c1008 08020000 02000000 04400000 00000201 00010120 18000a00 01000000 00500010 00000400 80000000 00000200 10000000 00000200 0006000a 00002000 00800e00 | 00000000 42000008 20000100 00010200 00000041 00000020 02000000 00000400 02000000 40080840 08000000 40009000 01008002 00200000 40040000 00080008 08000000 02000000 00000000 00220200 00000000 08000a08 01000000 00500010 00000000 80000000 00000080 00010000 00000000 00020002 00002000 00000400 |