On Target ACM1_HUMAN 0.7590361/CHEMBL3629534
For the given ligand Pethidine, we have found in our database that, being scored 0.7590361, the most similar ligand is CHEMBL3629534. Check out the elaboration below.
| Pethidine (Given Ligand) | CHEMBL3629534 (Similar Ligand) |
|---|---|
| CCOC(=O)C2(c1ccccc1)CCN(C)CC2 | COc1ccc(CCC(=O)OCC2(CCN(C)CC2)c3ccccc3)cc1 |
|
|
|
|
|
|
| 00020000 01000200 00100100 00010700 00100040 00000000 00000000 20000040 00000800 000808c0 08300000 50019000 05008002 00000000 40040000 000c1008 08020000 02000000 04400000 00000201 00010120 18000a00 01000000 00500010 00000400 80000000 00000200 10000000 00000200 0006000a 00002000 00800e00 | 00000040 01000208 20100108 00010700 00101040 00000000 02040000 20000040 00000800 000808c0 08300000 50019000 04008002 00000000 01040001 000c1008 08020000 02000000 04400008 00020201 00010120 18000a00 01000040 00500010 00000c00 80000000 00120200 10000000 00000200 0006000a 00000000 00000e00 |