On Target GRM5_HUMAN 0.42857143/CHEMBL92162
For the given ligand Methadone, we have found in our database that, being scored 0.42857143, the most similar ligand is CHEMBL92162. Check out the elaboration below.
| Methadone (Given Ligand) | CHEMBL92162 (Similar Ligand) |
|---|---|
| CCC(=O)C(CC(C)N(C)C)(c1ccccc1)c2ccccc2 | N[C@@](CC1c2ccccc2Sc3ccccc13)([C@@H]4C[C@@H](C4)C(=O)O)C(=O)O |
|
|
|
|
|
|
| 00030000 01000200 00100102 00010600 00000000 00000000 00000000 01000000 00000800 000808c0 08300000 40019000 05008000 00200000 40000000 00040000 00000000 02000000 00002000 00000001 00000100 18000210 00000000 00500010 00000000 a0000000 00000000 50000000 00000080 0006000a 00022000 00800600 | 00010000 01800200 00020102 00110600 000e0000 00100020 00000000 01004002 00000800 000808c0 08100400 6001b000 0c008018 01a00010 00000000 00080008 04001000 02000004 00602010 00000001 80000100 18000a00 03800000 00400019 00003000 a0000000 00000000 40001000 00000282 0007000a 00020100 00410420 |