On Target DRD3_HUMAN 0.6017699/CHEMBL399396
For the given ligand Pethidine, we have found in our database that, being scored 0.6017699, the most similar ligand is CHEMBL399396. Check out the elaboration below.
| Pethidine (Given Ligand) | CHEMBL399396 (Similar Ligand) |
|---|---|
| CCOC(=O)C2(c1ccccc1)CCN(C)CC2 | CCOC(=O)C1(CCN(Cc2c[nH]c3ccccc23)CC1)c4ccc(Cl)cc4 |
|
|
|
|
|
|
| 00020000 01000200 00100100 00010700 00100040 00000000 00000000 20000040 00000800 000808c0 08300000 50019000 05008002 00000000 40040000 000c1008 08020000 02000000 04400000 00000201 00010120 18000a00 01000000 00500010 00000400 80000000 00000200 10000000 00000200 0006000a 00002000 00800e00 | 10028002 01000a00 00100100 00010710 00141040 00000000 00004000 22001040 00000800 000808c0 09300004 50019800 07008826 00400000 40040440 000c100c 08020008 02000000 04600000 00000201 40010120 18008b08 21800000 80500010 00046400 c0000000 08040200 90000000 00000300 0006000a 2004a200 80820e20 |