On Target AGTR2_HUMAN 0.35135135/CHEMBL128416
For the given ligand Methadone, we have found in our database that, being scored 0.35135135, the most similar ligand is CHEMBL128416. Check out the elaboration below.
| Methadone (Given Ligand) | CHEMBL128416 (Similar Ligand) |
|---|---|
| CCC(=O)C(CC(C)N(C)C)(c1ccccc1)c2ccccc2 | OC(=O)C1Cc2ccccc2CN1C(=O)C(c3ccccc3)c4ccccc4 |
|
|
|
|
|
|
| 00030000 01000200 00100102 00010600 00000000 00000000 00000000 01000000 00000800 000808c0 08300000 40019000 05008000 00200000 40000000 00040000 00000000 02000000 00002000 00000001 00000100 18000210 00000000 00500010 00000000 a0000000 00000000 50000000 00000080 0006000a 00022000 00800600 | 00008008 00805000 00100100 10010600 000000a0 00000000 01001000 03001004 00000880 00080840 08300000 4000b000 07008882 00200000 c0080480 00080008 10000200 02000020 00400008 00000201 80020100 18208e00 03004040 81400018 00000800 e0000001 00004000 c0000000 04000180 00860003 20046000 00002600 |