On Target AGTR2_HUMAN 0.39534885/CHEMBL3350599
For the given ligand Pethidine, we have found in our database that, being scored 0.39534885, the most similar ligand is CHEMBL3350599. Check out the elaboration below.
| Pethidine (Given Ligand) | CHEMBL3350599 (Similar Ligand) |
|---|---|
| CCOC(=O)C2(c1ccccc1)CCN(C)CC2 | CC[C@H](C)[C@H](NC(=O)[C@H](N)NC(=O)[C@@H](NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@@H](N)CC(=O)O)C(C)C)C(=O)N[C@@H](Cc1ccccc1)C(=O)N2CCC[C@H]2C(=O)N[C@@H](Cc3ccccc3)C(=O)O |
|
|
|
|
|
|
| 00020000 01000200 00100100 00010700 00100040 00000000 00000000 20000040 00000800 000808c0 08300000 50019000 05008002 00000000 40040000 000c1008 08020000 02000000 04400000 00000201 00010120 18000a00 01000000 00500010 00000400 80000000 00000200 10000000 00000200 0006000a 00002000 00800e00 | 00070000 01007200 00100100 04010e00 00100082 00000010 00010000 2000200c 00200880 000808c2 08300010 4003b000 0e00b012 00002009 80180000 000c0008 10000810 02000000 00c00008 00000201 00000100 38250e20 03000043 83500018 00000800 80000000 40010000 10000000 0c000002 0006000b 20084000 00802e00 |