On Target P2Y12_HUMAN 0.37777779/CHEMBL328149
For the given ligand Pethidine, we have found in our database that, being scored 0.37777779, the most similar ligand is CHEMBL328149. Check out the elaboration below.
| Pethidine (Given Ligand) | CHEMBL328149 (Similar Ligand) |
|---|---|
| CCOC(=O)C2(c1ccccc1)CCN(C)CC2 | CCOC(=O)C1CCN(CC1)C(=O)CCCOc2ccc3[nH]c4nc(O)nc4cc3c2 |
|
|
|
|
|
|
| 00020000 01000200 00100100 00010700 00100040 00000000 00000000 20000040 00000800 000808c0 08300000 50019000 05008002 00000000 40040000 000c1008 08020000 02000000 04400000 00000201 00010120 18000a00 01000000 00500010 00000400 80000000 00000200 10000000 00000200 0006000a 00002000 00800e00 | 04064002 03001818 20184008 00010700 001c1040 0200c000 06088000 20000000 00400100 000008c0 00208004 50019000 04808806 00c00000 71040141 000c300c 08020000 00000100 00600000 00020201 40020020 18048e28 21800000 8010001c 00002400 00000000 00028200 10000000 00000200 00460001 c0040000 0c802e80 |