On Target NOS2_HUMAN 0.38356164/CHEMBL450583
For the given ligand Methadone, we have found in our database that, being scored 0.38356164, the most similar ligand is CHEMBL450583. Check out the elaboration below.
| Methadone (Given Ligand) | CHEMBL450583 (Similar Ligand) |
|---|---|
| CCC(=O)C(CC(C)N(C)C)(c1ccccc1)c2ccccc2 | Br.CCC(NC(=N)C)c1ccccc1 |
|
|
|
|
|
|
| 00030000 01000200 00100102 00010600 00000000 00000000 00000000 01000000 00000800 000808c0 08300000 40019000 05008000 00200000 40000000 00040000 00000000 02000000 00002000 00000001 00000100 18000210 00000000 00500010 00000000 a0000000 00000000 50000000 00000080 0006000a 00022000 00800600 | 00000000 00000000 00100100 00010600 00000000 00000000 00000000 02001000 00000a00 00080853 08300000 40008000 00000802 00000000 00000400 00100000 00000000 02000000 00000000 00000201 00000100 18008000 00000000 00400010 00000000 c0000000 40000000 90000000 00000110 00060002 00040008 00000600 |