On Target SCN9A_HUMAN 0.41284403/CHEMBL206758
For the given ligand Pethidine, we have found in our database that, being scored 0.41284403, the most similar ligand is CHEMBL206758. Check out the elaboration below.
| Pethidine (Given Ligand) | CHEMBL206758 (Similar Ligand) |
|---|---|
| CCOC(=O)C2(c1ccccc1)CCN(C)CC2 | OC(CCc1ccccc1)[C@@H]2CCC[C@H]2C(=O)NCc3cc(Cl)cc(Cl)c3 |
|
|
|
|
|
|
| 00020000 01000200 00100100 00010700 00100040 00000000 00000000 20000040 00000800 000808c0 08300000 50019000 05008002 00000000 40040000 000c1008 08020000 02000000 04400000 00000201 00010120 18000a00 01000000 00500010 00000400 80000000 00000200 10000000 00000200 0006000a 00002000 00800e00 | 00058000 09800000 00100102 00010600 00180000 00000020 04000000 22001000 00000800 000808c8 08300000 40019800 0600880e 00a00400 80000400 00080008 00000000 02000000 00402000 00000201 80000100 18008710 01000040 00500018 00002000 c0000000 00000000 90000000 00000102 01060003 20060000 00020e00 |