On Target PRGR_HUMAN 0.3816794/CHEMBL197161
For the given ligand Pethidine, we have found in our database that, being scored 0.3816794, the most similar ligand is CHEMBL197161. Check out the elaboration below.
| Pethidine (Given Ligand) | CHEMBL197161 (Similar Ligand) |
|---|---|
| CCOC(=O)C2(c1ccccc1)CCN(C)CC2 | CC(C)(CC(O)(Cc1ccccc1)C(=O)Nc2ccc3C(=O)OCc3c2)c4ccccc4 |
|
|
|
|
|
|
| 00020000 01000200 00100100 00010700 00100040 00000000 00000000 20000040 00000800 000808c0 08300000 50019000 05008002 00000000 40040000 000c1008 08020000 02000000 04400000 00000201 00010120 18000a00 01000000 00500010 00000400 80000000 00000200 10000000 00000200 0006000a 00002000 00800e00 | 00014002 01000a00 40101102 80090600 240000d0 0800e000 00000000 00000000 00100900 000808d0 08380004 4001d800 04008000 00318000 00060040 020c0008 08060000 02000200 08412008 80000001 40100100 18020f20 23002040 00500014 00040c00 80002000 08080000 10000080 00428202 0006000b c0000000 00400600 |