On Target PGH2_HUMAN 0.446281/CHEMBL49775
For the given ligand Fentanyl, we have found in our database that, being scored 0.446281, the most similar ligand is CHEMBL49775. Check out the elaboration below.
| Fentanyl (Given Ligand) | CHEMBL49775 (Similar Ligand) |
|---|---|
| CCC(=O)N(c1ccccc1)C3CCN(CCc2ccccc2)CC3 | CS(=O)(=O)c1ccc(cc1)C2=C(C(=O)N(C2)c3ccccc3)c4ccccc4 |
|
|
|
|
|
|
| 00004002 01001400 00100100 00010600 20000000 00000000 00000000 20000000 00000080 000809e0 08280004 50019000 00008002 00100000 00020040 00000000 00040000 02000000 08000000 00000201 60100000 18280600 20002000 81500018 00000000 80000000 00000000 10000080 04008000 00060013 00000000 00002600 | 00004202 00809200 00120100 00910600 20000000 08000000 80000080 00000404 01800080 00480840 08282104 60009008 01008002 00110000 c0220042 00000000 24040400 02000100 48018000 00802200 c0100000 18240700 20802000 89400019 00000000 88000000 00402000 400101a0 04408000 00060003 0c002000 00012620 |