On Target TRY1_HUMAN 0.4678899/CHEMBL134821
For the given ligand Pethidine, we have found in our database that, being scored 0.4678899, the most similar ligand is CHEMBL134821. Check out the elaboration below.
| Pethidine (Given Ligand) | CHEMBL134821 (Similar Ligand) |
|---|---|
| CCOC(=O)C2(c1ccccc1)CCN(C)CC2 | CC(C)(C(CCc1ccccc1)NC(=O)c2ccccc2)C(=O)OC(=O)C(C)(C)C(CCc3ccccc3)NC(=O)c4ccccc4 |
|
|
|
|
|
|
| 00020000 01000200 00100100 00010700 00100040 00000000 00000000 20000040 00000800 000808c0 08300000 50019000 05008002 00000000 40040000 000c1008 08020000 02000000 04400000 00000201 00010120 18000a00 01000000 00500010 00000400 80000000 00000200 10000000 00000200 0006000a 00002000 00800e00 | 00810040 01001a00 00100102 00010700 00080000 00000000 00000000 22001000 00000800 000808c0 08300000 40009000 0c00880a 00a80000 00000400 000c1008 00a20000 02000001 00c02010 00000201 00000120 18168e00 01000080 0040001c 00001401 c0000000 00000000 90000000 00000302 0006000f a0040000 00000600 |