On Target 5HT1B_HUMAN 0.42666668/CHEMBL146942
For the given ligand Methadone, we have found in our database that, being scored 0.42666668, the most similar ligand is CHEMBL146942. Check out the elaboration below.
| Methadone (Given Ligand) | CHEMBL146942 (Similar Ligand) |
|---|---|
| CCC(=O)C(CC(C)N(C)C)(c1ccccc1)c2ccccc2 | NCCCC1(CCCN)CCc2cccc(O)c2C1 |
|
|
|
|
|
|
| 00030000 01000200 00100102 00010600 00000000 00000000 00000000 01000000 00000800 000808c0 08300000 40019000 05008000 00200000 40000000 00040000 00000000 02000000 00002000 00000001 00000100 18000210 00000000 00500010 00000000 a0000000 00000000 50000000 00000080 0006000a 00022000 00800600 | 00000000 43000008 20000102 00010600 00000000 40000002 02000000 00000201 00000800 000808c0 08100000 40018040 00000002 00200000 00000020 00002008 00000200 02000000 00002000 00020201 00000100 18000010 00004000 00400010 00000000 80000001 00000000 00000000 00000002 00064002 00020000 00000400 |