On Target TLR4_HUMAN 0.3138686/CHEMBL382272
For the given ligand Methadone, we have found in our database that, being scored 0.3138686, the most similar ligand is CHEMBL382272. Check out the elaboration below.
| Methadone (Given Ligand) | CHEMBL382272 (Similar Ligand) |
|---|---|
| CCC(=O)C(CC(C)N(C)C)(c1ccccc1)c2ccccc2 | CCCCCCCCCCCCCC(=O)N[C@H](COCC[C@@H](CCCCCCC)OC(=O)CCCCCCCCCCC)COP(=O)(O)OCCNC(=O)C(Cc1ccc(O)cc1)C(=O)O |
|
|
|
|
|
|
| 00030000 01000200 00100102 00010600 00000000 00000000 00000000 01000000 00000800 000808c0 08300000 40019000 05008000 00200000 40000000 00040000 00000000 02000000 00002000 00000001 00000100 18000210 00000000 00500010 00000000 a0000000 00000000 50000000 00000080 0006000a 00022000 00800600 | 00010040 01004208 20100100 80010f00 000800c4 00080000 02004040 20002000 00000900 010808c0 08300000 c0019000 1c00800a 00820020 000a1008 000c1608 108e00a0 02800000 21c02018 00023203 00000120 1c000e10 330000c0 00500018 10001c01 80000000 02920000 10010001 00000200 0006001b 01020000 00018600 |