On Target OPRD_HUMAN 0.56/CHEMBL3915012
For the given ligand Pethidine, we have found in our database that, being scored 0.56, the most similar ligand is CHEMBL3915012. Check out the elaboration below.
| Pethidine (Given Ligand) | CHEMBL3915012 (Similar Ligand) |
|---|---|
| CCOC(=O)C2(c1ccccc1)CCN(C)CC2 | COC(=O)CCC(=O)N(CCN1[C@@H]2CC[C@H]1C[C@H](C2)c3cccc(O)c3)CC4CCCCC4 |
|
|
|
|
|
|
| 00020000 01000200 00100100 00010700 00100040 00000000 00000000 20000040 00000800 000808c0 08300000 50019000 05008002 00000000 40040000 000c1008 08020000 02000000 04400000 00000201 00010120 18000a00 01000000 00500010 00000400 80000000 00000200 10000000 00000200 0006000a 00002000 00800e00 | 00060000 43003208 20100102 04010700 00100000 40000010 02000000 20000008 00000800 000808c0 08300000 50019000 04008002 00202000 00000000 000c0008 00020000 02000100 02402000 00020201 00000100 38040e10 01000001 02500018 00000000 80000000 00000200 10001000 08000202 0006000b 00020000 00802e00 |