On Target CNR2_HUMAN 0.5268817/CHEMBL1765274
For the given ligand Pethidine, we have found in our database that, being scored 0.5268817, the most similar ligand is CHEMBL1765274. Check out the elaboration below.
| Pethidine (Given Ligand) | CHEMBL1765274 (Similar Ligand) |
|---|---|
| CCOC(=O)C2(c1ccccc1)CCN(C)CC2 | CN1CCC(CC1)C(=O)N2CC[C@](O)([C@@H]3CCCC[C@H]23)c4ccccc4 |
|
|
|
|
|
|
| 00020000 01000200 00100100 00010700 00100040 00000000 00000000 20000040 00000800 000808c0 08300000 50019000 05008002 00000000 40040000 000c1008 08020000 02000000 04400000 00000201 00010120 18000a00 01000000 00500010 00000400 80000000 00000200 10000000 00000200 0006000a 00002000 00800e00 | 00020000 01001200 00100102 00010600 00080000 00004000 00000000 20000000 00200900 000808c0 08300000 50039000 04008002 00a00000 00000000 000c0008 00000000 02000000 02c02000 00000201 00000100 18140630 01000080 00500018 00000001 80000000 00000000 10000000 00000002 0006000b 40020000 00802600 |