On Target NTRK1_HUMAN 0.29661018/CHEMBL1978371
For the given ligand Methadone, we have found in our database that, being scored 0.29661018, the most similar ligand is CHEMBL1978371. Check out the elaboration below.
| Methadone (Given Ligand) | CHEMBL1978371 (Similar Ligand) |
|---|---|
| CCC(=O)C(CC(C)N(C)C)(c1ccccc1)c2ccccc2 | Clc1ccc(cc1)C2CC(=C(C#N)C(=O)C2C(=O)c3ccccc3)c4ccccc4 |
|
|
|
|
|
|
| 00030000 01000200 00100102 00010600 00000000 00000000 00000000 01000000 00000800 000808c0 08300000 40019000 05008000 00200000 40000000 00040000 00000000 02000000 00002000 00000001 00000100 18000210 00000000 00500010 00000000 a0000000 00000000 50000000 00000080 0006000a 00022000 00800600 | 00018000 01000800 00000302 00110620 00000000 00080000 90000080 00000402 01800900 00188842 08100000 40029800 0602802c 00200000 00000403 00020000 00400400 02000020 0001a008 02000001 00000100 18020380 00008420 00400014 01202802 80002000 00446100 c0000000 00480002 80060002 a4020000 00030480 |