On Target NTRK1_HUMAN 0.3119266/CHEMBL1984131
For the given ligand Pethidine, we have found in our database that, being scored 0.3119266, the most similar ligand is CHEMBL1984131. Check out the elaboration below.
| Pethidine (Given Ligand) | CHEMBL1984131 (Similar Ligand) |
|---|---|
| CCOC(=O)C2(c1ccccc1)CCN(C)CC2 | CCOC(=O)C(C(=O)N)C(=S)Nc1ccc(C)cc1 |
|
|
|
|
|
|
| 00020000 01000200 00100100 00010700 00100040 00000000 00000000 20000040 00000800 000808c0 08300000 50019000 05008002 00000000 40040000 000c1008 08020000 02000000 04400000 00000201 00010120 18000a00 01000000 00500010 00000400 80000000 00000200 10000000 00000200 0006000a 00002000 00800e00 | 00004002 00000800 00100100 00010600 20040000 00200000 00000000 20000000 00000100 00000940 00200004 50019000 18088000 04088000 00020060 00080008 00266000 02000800 08800010 00000300 60141020 18000e00 21000080 00400010 00000400 80000000 00000000 00000080 00008200 00060010 00000000 00090208 |