On Target MTOR_HUMAN 0.40816328/CHEMBL3972399
For the given ligand Pethidine, we have found in our database that, being scored 0.40816328, the most similar ligand is CHEMBL3972399. Check out the elaboration below.
| Pethidine (Given Ligand) | CHEMBL3972399 (Similar Ligand) |
|---|---|
| CCOC(=O)C2(c1ccccc1)CCN(C)CC2 | CCCNC(=O)CC[C@@]1(C)[C@@H](CC[C@]2(C)[C@@H]1C[C@@H](F)C34OC(=O)[C@@]5(CC[C@@H](C)[C@H](C)[C@@H]35)CC[C@@]24C)C(=C)C |
|
|
|
|
|
|
| 00020000 01000200 00100100 00010700 00100040 00000000 00000000 20000040 00000800 000808c0 08300000 50019000 05008002 00000000 40040000 000c1008 08020000 02000000 04400000 00000201 00010120 18000a00 01000000 00500010 00000400 80000000 00000200 10000000 00000200 0006000a 00002000 00800e00 | 00050040 01001000 00100100 00010700 00081400 00000000 00000004 20000400 00000000 00100080 00240000 40019000 0400800a 00800000 00080400 00081008 00820000 00400000 02402000 00000201 00000120 10000e10 01000000 00500018 00000400 00000000 00000020 90000000 00000200 02040003 24020000 00002600 |