On Target OPRX_HUMAN 0.7111111/CHEMBL364625
For the given ligand Pethidine, we have found in our database that, being scored 0.7111111, the most similar ligand is CHEMBL364625. Check out the elaboration below.
| Pethidine (Given Ligand) | CHEMBL364625 (Similar Ligand) |
|---|---|
| CCOC(=O)C2(c1ccccc1)CCN(C)CC2 | COC(=O)C(CCN1CCC(O)(CC1)c2cccc(c2)C(F)(F)F)(c3ccccc3)c4ccccc4 |
|
|
|
|
|
|
| 00020000 01000200 00100100 00010700 00100040 00000000 00000000 20000040 00000800 000808c0 08300000 50019000 05008002 00000000 40040000 000c1008 08020000 02000000 04400000 00000201 00010120 18000a00 01000000 00500010 00000400 80000000 00000200 10000000 00000200 0006000a 00002000 00800e00 | 00020000 01050200 00100100 00010700 00100041 00004000 00000400 21000040 00000900 000808d0 08300000 50019002 05008002 01000000 40040000 000c0008 08020000 02000000 04c00000 40000201 00000100 18000a20 01000080 00500010 00000001 a0000000 00000200 d0000000 00000280 0006000a 40102000 00802e00 |