On Target FYN_HUMAN 0.50574714/CHEMBL305660
For the given ligand Methadone, we have found in our database that, being scored 0.50574714, the most similar ligand is CHEMBL305660. Check out the elaboration below.
| Methadone (Given Ligand) | CHEMBL305660 (Similar Ligand) |
|---|---|
| CCC(=O)C(CC(C)N(C)C)(c1ccccc1)c2ccccc2 | CC(C)(C)c1ccc(cc1)C(=O)CCCN2CCC(CC2)OC(c3ccccc3)c4ccccc4 |
|
|
|
|
|
|
| 00030000 01000200 00100102 00010600 00000000 00000000 00000000 01000000 00000800 000808c0 08300000 40019000 05008000 00200000 40000000 00040000 00000000 02000000 00002000 00000001 00000100 18000210 00000000 00500010 00000000 a0000000 00000000 50000000 00000080 0006000a 00022000 00800600 | 00020000 01000800 00100102 40010600 00000010 00004000 00000000 21000000 00100900 000808c0 08300000 50019800 04008002 00290000 00000000 02080008 00200000 02000000 00800000 00000201 00000120 18020220 01000080 00500014 00000401 a0002000 00080000 50000000 00000280 00060002 c0000000 02802600 |