On Target CAH2_HUMAN 0.4597701/CHEMBL2023729
For the given ligand Pethidine, we have found in our database that, being scored 0.4597701, the most similar ligand is CHEMBL2023729. Check out the elaboration below.
| Pethidine (Given Ligand) | CHEMBL2023729 (Similar Ligand) |
|---|---|
| CCOC(=O)C2(c1ccccc1)CCN(C)CC2 | [Na+].[S-]C(=S)N1CCC(CC1)(C#N)c2ccccc2 |
|
|
|
|
|
|
| 00020000 01000200 00100100 00010700 00100040 00000000 00000000 20000040 00000800 000808c0 08300000 50019000 05008002 00000000 40040000 000c1008 08020000 02000000 04400000 00000201 00010120 18000a00 01000000 00500010 00000400 80000000 00000200 10000000 00000200 0006000a 00002000 00800e00 | 00000000 01000200 00104100 00110e00 00000000 00000000 00000000 20002000 00000c00 000808c0 08300000 50018000 00002002 00080000 00000000 00040004 00410010 02000200 00000000 00040201 00000100 18000000 00800400 00500010 00000000 80000000 00000000 10000000 00200000 0006000a 00000000 00010e88 |