On Target CDK5_HUMAN 0.525641/CHEMBL1988201
For the given ligand Methadone, we have found in our database that, being scored 0.525641, the most similar ligand is CHEMBL1988201. Check out the elaboration below.
| Methadone (Given Ligand) | CHEMBL1988201 (Similar Ligand) |
|---|---|
| CCC(=O)C(CC(C)N(C)C)(c1ccccc1)c2ccccc2 | CN(C)CCC1Cc2ccccc2C(=C)c3ccccc13 |
|
|
|
|
|
|
| 00030000 01000200 00100102 00010600 00000000 00000000 00000000 01000000 00000800 000808c0 08300000 40019000 05008000 00200000 40000000 00040000 00000000 02000000 00002000 00000001 00000100 18000210 00000000 00500010 00000000 a0000000 00000000 50000000 00000080 0006000a 00022000 00800600 | 00000000 01000200 00100102 00010600 20000000 00002002 80000480 01000401 04100800 000808c0 08300000 40018000 00000000 00200000 00000020 02040000 00000000 02000000 00100000 00000001 00100100 18100000 00404000 00500810 00000000 a0000001 00002000 50000000 02400080 0006000a 04000000 00000700 |