On Target CDK5_HUMAN 0.35714287/CHEMBL1988201
For the given ligand Pethidine, we have found in our database that, being scored 0.35714287, the most similar ligand is CHEMBL1988201. Check out the elaboration below.
| Pethidine (Given Ligand) | CHEMBL1988201 (Similar Ligand) |
|---|---|
| CCOC(=O)C2(c1ccccc1)CCN(C)CC2 | CN(C)CCC1Cc2ccccc2C(=C)c3ccccc13 |
|
|
|
|
|
|
| 00020000 01000200 00100100 00010700 00100040 00000000 00000000 20000040 00000800 000808c0 08300000 50019000 05008002 00000000 40040000 000c1008 08020000 02000000 04400000 00000201 00010120 18000a00 01000000 00500010 00000400 80000000 00000200 10000000 00000200 0006000a 00002000 00800e00 | 00000000 01000200 00100102 00010600 20000000 00002002 80000480 01000401 04100800 000808c0 08300000 40018000 00000000 00200000 00000020 02040000 00000000 02000000 00100000 00000001 00100100 18100000 00404000 00500810 00000000 a0000001 00002000 50000000 02400080 0006000a 04000000 00000700 |