On Target ESR1_HUMAN 0.5316456/CHEMBL335412
For the given ligand Pethidine, we have found in our database that, being scored 0.5316456, the most similar ligand is CHEMBL335412. Check out the elaboration below.
| Pethidine (Given Ligand) | CHEMBL335412 (Similar Ligand) |
|---|---|
| CCOC(=O)C2(c1ccccc1)CCN(C)CC2 | COC(=O)C(Cc1ccc(O)cc1)c2ccc(O)cc2 |
|
|
|
|
|
|
| 00020000 01000200 00100100 00010700 00100040 00000000 00000000 20000040 00000800 000808c0 08300000 50019000 05008002 00000000 40040000 000c1008 08020000 02000000 04400000 00000201 00010120 18000a00 01000000 00500010 00000400 80000000 00000200 10000000 00000200 0006000a 00002000 00800e00 | 00000000 00000008 20000100 00010300 00000040 00000000 02000000 00000040 00000800 00080840 08100000 40009000 05008002 00000000 40040000 00080008 08020000 02000000 04400008 00020001 00000100 08100a00 01000040 00400010 00000800 80000000 00120000 00000000 00000200 00020002 00002000 00000500 |