On Target 5HT2C_HUMAN 0.6436782/CHEMBL517712
For the given ligand Pethidine, we have found in our database that, being scored 0.6436782, the most similar ligand is CHEMBL517712. Check out the elaboration below.
| Pethidine (Given Ligand) | CHEMBL517712 (Similar Ligand) |
|---|---|
| CCOC(=O)C2(c1ccccc1)CCN(C)CC2 | CN1[C@@H]2CC[C@H]1C[C@H](C2)OC(=O)C(CO)c3ccccc3 |
|
|
|
|
|
|
| 00020000 01000200 00100100 00010700 00100040 00000000 00000000 20000040 00000800 000808c0 08300000 50019000 05008002 00000000 40040000 000c1008 08020000 02000000 04400000 00000201 00010120 18000a00 01000000 00500010 00000400 80000000 00000200 10000000 00000200 0006000a 00002000 00800e00 | 00000040 01000000 00100100 00010700 00080040 00000010 00000000 20000040 00000000 010808c0 08200000 50019000 11008002 00880000 40040000 00081008 08a20000 02000000 05c02000 00000201 00010020 18000a10 01000080 00500010 00000401 80000000 00000000 10001000 00000200 00060006 00022000 00002600 |