On Target PTGES_HUMAN 0.53333336/CHEMBL4086788
For the given ligand Fentanyl, we have found in our database that, being scored 0.53333336, the most similar ligand is CHEMBL4086788. Check out the elaboration below.
| Fentanyl (Given Ligand) | CHEMBL4086788 (Similar Ligand) |
|---|---|
| CCC(=O)N(c1ccccc1)C3CCN(CCc2ccccc2)CC3 | CC(C)(C)C(=O)N[C@H]1CCC[C@H]1CNc2cc(Cl)ccc2C(=O)O |
|
|
|
|
|
|
| 00004002 01001400 00100100 00010600 20000000 00000000 00000000 20000000 00000080 000809e0 08280004 50019000 00008002 00100000 00020040 00000000 00040000 02000000 08000000 00000201 60100000 18280600 20002000 81500018 00000000 80000000 00000000 10000080 04008000 00060013 00000000 00002600 | 1001c002 01001c00 00100100 01010600 20000000 00016040 08000000 20000000 00800100 000809e0 00200004 40019800 06008086 00000001 00020040 0008000a 00040000 02000000 08002000 00004201 60100000 180e0f30 20000000 0050001c 00002000 80000000 00040000 10001080 00008000 01060011 c0000000 00022200 |