On Target PTGES_HUMAN 0.407767/CHEMBL3919693
For the given ligand Pethidine, we have found in our database that, being scored 0.407767, the most similar ligand is CHEMBL3919693. Check out the elaboration below.
| Pethidine (Given Ligand) | CHEMBL3919693 (Similar Ligand) |
|---|---|
| CCOC(=O)C2(c1ccccc1)CCN(C)CC2 | CC1(C)CN(CC[C@H]1C(=O)N[C@H]2CCC[C@H](CO)C2)c3ccc(cc3)C(F)(F)F |
|
|
|
|
|
|
| 00020000 01000200 00100100 00010700 00100040 00000000 00000000 20000040 00000800 000808c0 08300000 50019000 05008002 00000000 40040000 000c1008 08020000 02000000 04400000 00000201 00010120 18000a00 01000000 00500010 00000400 80000000 00000200 10000000 00000200 0006000a 00002000 00800e00 | 00024002 01001800 00100100 00010600 20180000 00002000 00000400 20000000 00200000 000008d0 00200004 50039000 04008002 01808000 00020040 00080008 00040000 02000000 0a402000 00000201 40100000 18040610 21000000 00500018 00000000 80000000 00000200 90000080 00008000 00060001 00120000 00802a00 |